C15H23N3 — CID 110138265
(4aS,8aR)-4a-methyl-5-(pyridin-2-ylmethyl)-1,2,3,4,6,7,8,8a-octahydro-1,5-naphthyridine (PubChem CID 110138265) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is (4aS,8aR)-4a-methyl-5-(pyridin-2-ylmethyl)-1,2,3,4,6,7,8,8a-octahydro-1,5-naphthyridine.
| Compound Name | (4aS,8aR)-4a-methyl-5-(pyridin-2-ylmethyl)-1,2,3,4,6,7,8,8a-octahydro-1,5-naphthyridine |
|---|---|
| PubChem CID | 110138265 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | (4aS,8aR)-4a-methyl-5-(pyridin-2-ylmethyl)-1,2,3,4,6,7,8,8a-octahydro-1,5-naphthyridine |
| SMILES | C[C@]12CCCN[C@@H]1CCCN2Cc1ccccn1 |
| InChI | InChI=1S/C15H23N3/c1-15-8-5-10-17-14(15)7-4-11-18(15)12-13-6-2-3-9-16-13/h2-3,6,9,14,17H,4-5,7-8,10-12H2,1H3/t14-,15+/m1/s1 |
| InChIKey | FBOLOFBWKTVUDZ-CABCVRRESA-N |
| XLogP | 2.19 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |