C12H16Br3N — CID 104813519
3-[2,2-bis(bromomethyl)pentyl]-5-bromopyridine (PubChem CID 104813519) has the molecular formula C12H16Br3N and a molecular weight of 413.98 g/mol. Its IUPAC name is 3-[2,2-bis(bromomethyl)pentyl]-5-bromopyridine.
| Compound Name | 3-[2,2-bis(bromomethyl)pentyl]-5-bromopyridine |
|---|---|
| PubChem CID | 104813519 |
| Molecular Formula | C12H16Br3N |
| Molecular Weight | 413.98 g/mol |
| Exact Mass | 410.88 |
| IUPAC Name | 3-[2,2-bis(bromomethyl)pentyl]-5-bromopyridine |
| SMILES | CCCC(CBr)(CBr)Cc1cncc(Br)c1 |
| InChI | InChI=1S/C12H16Br3N/c1-2-3-12(8-13,9-14)5-10-4-11(15)7-16-6-10/h4,6-7H,2-3,5,8-9H2,1H3 |
| InChIKey | JHPLTNHJGKXWFJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.98 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|