C14H23BrN2 — CID 113455824
2-[(5-bromo-3-pyridinyl)methyl]-N,2-diethylbutan-1-amine (PubChem CID 113455824) has the molecular formula C14H23BrN2 and a molecular weight of 299.26 g/mol. Its IUPAC name is 2-[(5-bromo-3-pyridinyl)methyl]-N,2-diethylbutan-1-amine.
| Compound Name | 2-[(5-bromo-3-pyridinyl)methyl]-N,2-diethylbutan-1-amine |
|---|---|
| PubChem CID | 113455824 |
| Molecular Formula | C14H23BrN2 |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-[(5-bromo-3-pyridinyl)methyl]-N,2-diethylbutan-1-amine |
| SMILES | CCNCC(CC)(CC)Cc1cncc(Br)c1 |
| InChI | InChI=1S/C14H23BrN2/c1-4-14(5-2,11-16-6-3)8-12-7-13(15)10-17-9-12/h7,9-10,16H,4-6,8,11H2,1-3H3 |
| InChIKey | VWPIOQNVVWOKTP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |