C11H9BrCl2N2O2S2 — CID 104814671
N-(5-amino-2-bromo-4-methylphenyl)-2,5-dichlorothiophene-3-sulfonamide (PubChem CID 104814671) has the molecular formula C11H9BrCl2N2O2S2 and a molecular weight of 416.15 g/mol. Its IUPAC name is N-(5-amino-2-bromo-4-methylphenyl)-2,5-dichlorothiophene-3-sulfonamide.
| Compound Name | N-(5-amino-2-bromo-4-methylphenyl)-2,5-dichlorothiophene-3-sulfonamide |
|---|---|
| PubChem CID | 104814671 |
| Molecular Formula | C11H9BrCl2N2O2S2 |
| Molecular Weight | 416.15 g/mol |
| Exact Mass | 413.87 |
| IUPAC Name | N-(5-amino-2-bromo-4-methylphenyl)-2,5-dichlorothiophene-3-sulfonamide |
| SMILES | Cc1cc(Br)c(NS(=O)(=O)c2cc(Cl)sc2Cl)cc1N |
| InChI | InChI=1S/C11H9BrCl2N2O2S2/c1-5-2-6(12)8(3-7(5)15)16-20(17,18)9-4-10(13)19-11(9)14/h2-4,16H,15H2,1H3 |
| InChIKey | MOYTULPVJZQZJM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.15 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|