C14H14BrN3O3 — CID 104815337
N-(2-bromo-4-methyl-5-nitrophenyl)-1-cyano-3-methylcyclobutane-1-carboxamide (PubChem CID 104815337) has the molecular formula C14H14BrN3O3 and a molecular weight of 352.19 g/mol. Its IUPAC name is N-(2-bromo-4-methyl-5-nitrophenyl)-1-cyano-3-methylcyclobutane-1-carboxamide.
| Compound Name | N-(2-bromo-4-methyl-5-nitrophenyl)-1-cyano-3-methylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 104815337 |
| Molecular Formula | C14H14BrN3O3 |
| Molecular Weight | 352.19 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | N-(2-bromo-4-methyl-5-nitrophenyl)-1-cyano-3-methylcyclobutane-1-carboxamide |
| SMILES | Cc1cc(Br)c(NC(=O)C2(C#N)CC(C)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H14BrN3O3/c1-8-5-14(6-8,7-16)13(19)17-11-4-12(18(20)21)9(2)3-10(11)15/h3-4,8H,5-6H2,1-2H3,(H,17,19) |
| InChIKey | GWYXWWVINUMDIQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.19 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|