2-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]acetic acid

C6H10N4O5S — CID 104816689

IUPAC2-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]acetic acid
SMILESCCOc1n[nH]c(NS(=O)(=O)CC(=O)O)n1
InChIInChI=1S/C6H10N4O5S/c1-2-15-6-7-5(8-9-6)10-16(13,14)3-4(11)12/h2-3H2,1H3,(H,11,12)(H2,7,8,9,10)
InChIKeyHWKUGHQNDOCTDN-UHFFFAOYSA-N
MW250.24 g/mol
LogP-0.97
Rot. Bonds6

About 2-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]acetic acid

2-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]acetic acid (PubChem CID 104816689) has the molecular formula C6H10N4O5S and a molecular weight of 250.24 g/mol. Its IUPAC name is 2-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]acetic acid.

Molecular Properties

Compound Name2-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]acetic acid
PubChem CID104816689
Molecular FormulaC6H10N4O5S
Molecular Weight250.24 g/mol
Exact Mass250.04
IUPAC Name2-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]acetic acid
SMILESCCOc1n[nH]c(NS(=O)(=O)CC(=O)O)n1
InChIInChI=1S/C6H10N4O5S/c1-2-15-6-7-5(8-9-6)10-16(13,14)3-4(11)12/h2-3H2,1H3,(H,11,12)(H2,7,8,9,10)
InChIKeyHWKUGHQNDOCTDN-UHFFFAOYSA-N
XLogP-0.97
TPSA134.27 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.24
LogP ≤ 5-0.97
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Analyze 2-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]acetic acid?
The IUPAC name of 2-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]acetic acid (CID 104816689) is 2-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]acetic acid.
What is the SMILES notation for 2-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]acetic acid?
The canonical SMILES for 2-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]acetic acid is CCOc1n[nH]c(NS(=O)(=O)CC(=O)O)n1.
What is the InChIKey of 2-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]acetic acid?
The InChIKey is HWKUGHQNDOCTDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O5S/c1-2-15-6-7-5(8-9-6)10-16(13,14)3-4(11)12/h2-3H2,1H3,(H,11,12)(H2,7,8,9,10).
What are the key properties of 2-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]acetic acid?
2-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]acetic acid has a molecular weight of 250.24 g/mol, XLogP of -0.97, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]acetic acid is sourced from PubChem (CID 104816689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).