C6H10N4O5S — CID 104816689
2-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]acetic acid (PubChem CID 104816689) has the molecular formula C6H10N4O5S and a molecular weight of 250.24 g/mol. Its IUPAC name is 2-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]acetic acid.
| Compound Name | 2-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]acetic acid |
|---|---|
| PubChem CID | 104816689 |
| Molecular Formula | C6H10N4O5S |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 2-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]acetic acid |
| SMILES | CCOc1n[nH]c(NS(=O)(=O)CC(=O)O)n1 |
| InChI | InChI=1S/C6H10N4O5S/c1-2-15-6-7-5(8-9-6)10-16(13,14)3-4(11)12/h2-3H2,1H3,(H,11,12)(H2,7,8,9,10) |
| InChIKey | HWKUGHQNDOCTDN-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |