C11H11ClN4O2S — CID 104818122
(E)-3-(5-chlorothiophen-2-yl)-N-(3-ethoxy-1H-1,2,4-triazol-5-yl)prop-2-enamide (PubChem CID 104818122) has the molecular formula C11H11ClN4O2S and a molecular weight of 298.76 g/mol. Its IUPAC name is (E)-3-(5-chlorothiophen-2-yl)-N-(3-ethoxy-1H-1,2,4-triazol-5-yl)prop-2-enamide.
| Compound Name | (E)-3-(5-chlorothiophen-2-yl)-N-(3-ethoxy-1H-1,2,4-triazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 104818122 |
| Molecular Formula | C11H11ClN4O2S |
| Molecular Weight | 298.76 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | (E)-3-(5-chlorothiophen-2-yl)-N-(3-ethoxy-1H-1,2,4-triazol-5-yl)prop-2-enamide |
| SMILES | CCOc1n[nH]c(NC(=O)/C=C/c2ccc(Cl)s2)n1 |
| InChI | InChI=1S/C11H11ClN4O2S/c1-2-18-11-14-10(15-16-11)13-9(17)6-4-7-3-5-8(12)19-7/h3-6H,2H2,1H3,(H2,13,14,15,16,17)/b6-4+ |
| InChIKey | PNUFTGZNLSBDJW-GQCTYLIASA-N |
| XLogP | 2.57 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.76 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|