C12H10Cl2N4O2 — CID 83102269
(E)-3-(2,5-dichlorophenyl)-N-(3-methoxy-1H-1,2,4-triazol-5-yl)prop-2-enamide (PubChem CID 83102269) has the molecular formula C12H10Cl2N4O2 and a molecular weight of 313.14 g/mol. Its IUPAC name is (E)-3-(2,5-dichlorophenyl)-N-(3-methoxy-1H-1,2,4-triazol-5-yl)prop-2-enamide.
| Compound Name | (E)-3-(2,5-dichlorophenyl)-N-(3-methoxy-1H-1,2,4-triazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 83102269 |
| Molecular Formula | C12H10Cl2N4O2 |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | (E)-3-(2,5-dichlorophenyl)-N-(3-methoxy-1H-1,2,4-triazol-5-yl)prop-2-enamide |
| SMILES | COc1n[nH]c(NC(=O)/C=C/c2cc(Cl)ccc2Cl)n1 |
| InChI | InChI=1S/C12H10Cl2N4O2/c1-20-12-16-11(17-18-12)15-10(19)5-2-7-6-8(13)3-4-9(7)14/h2-6H,1H3,(H2,15,16,17,18,19)/b5-2+ |
| InChIKey | JTSYFCMQZUIPGA-GORDUTHDSA-N |
| XLogP | 2.77 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|