C10H6ClN5O4 — CID 104820299
N-(6-chloro-3-nitro-2-pyridinyl)-6-oxo-1H-pyrazine-3-carboxamide (PubChem CID 104820299) has the molecular formula C10H6ClN5O4 and a molecular weight of 295.64 g/mol. Its IUPAC name is N-(6-chloro-3-nitro-2-pyridinyl)-6-oxo-1H-pyrazine-3-carboxamide.
| Compound Name | N-(6-chloro-3-nitro-2-pyridinyl)-6-oxo-1H-pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 104820299 |
| Molecular Formula | C10H6ClN5O4 |
| Molecular Weight | 295.64 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | N-(6-chloro-3-nitro-2-pyridinyl)-6-oxo-1H-pyrazine-3-carboxamide |
| SMILES | O=C(Nc1nc(Cl)ccc1[N+](=O)[O-])c1c[nH]c(=O)cn1 |
| InChI | InChI=1S/C10H6ClN5O4/c11-7-2-1-6(16(19)20)9(14-7)15-10(18)5-3-13-8(17)4-12-5/h1-4H,(H,13,17)(H,14,15,18) |
| InChIKey | MFHXNMNXYJERSL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.64 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|