C15H17FN2O2S — CID 104821544
4-tert-butyl-N-(6-fluoro-2-pyridinyl)benzenesulfonamide (PubChem CID 104821544) has the molecular formula C15H17FN2O2S and a molecular weight of 308.38 g/mol. Its IUPAC name is 4-tert-butyl-N-(6-fluoro-2-pyridinyl)benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-(6-fluoro-2-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 104821544 |
| Molecular Formula | C15H17FN2O2S |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 4-tert-butyl-N-(6-fluoro-2-pyridinyl)benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2cccc(F)n2)cc1 |
| InChI | InChI=1S/C15H17FN2O2S/c1-15(2,3)11-7-9-12(10-8-11)21(19,20)18-14-6-4-5-13(16)17-14/h4-10H,1-3H3,(H,17,18) |
| InChIKey | KXIVTIAVHKLTKP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|