C29H25N3O5 — CID 10482173
N-(9,10-dioxoanthracen-2-yl)-2-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]acetamide (PubChem CID 10482173) has the molecular formula C29H25N3O5 and a molecular weight of 495.54 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-2-yl)-2-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]acetamide.
| Compound Name | N-(9,10-dioxoanthracen-2-yl)-2-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 10482173 |
| Molecular Formula | C29H25N3O5 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | N-(9,10-dioxoanthracen-2-yl)-2-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]acetamide |
| SMILES | O=C(CN1CCC(N2C(=O)OCc3ccccc32)CC1)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C29H25N3O5/c33-26(30-19-9-10-23-24(15-19)28(35)22-7-3-2-6-21(22)27(23)34)16-31-13-11-20(12-14-31)32-25-8-4-1-5-18(25)17-37-29(32)36/h1-10,15,20H,11-14,16-17H2,(H,30,33) |
| InChIKey | LNYRUONHRRMOCZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|