C21H22ClN3O4 — CID 11408358
2-[4-(6-chloro-2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]-N-(4-hydroxyphenyl)acetamide (PubChem CID 11408358) has the molecular formula C21H22ClN3O4 and a molecular weight of 415.88 g/mol. Its IUPAC name is 2-[4-(6-chloro-2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]-N-(4-hydroxyphenyl)acetamide.
| Compound Name | 2-[4-(6-chloro-2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]-N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 11408358 |
| Molecular Formula | C21H22ClN3O4 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 2-[4-(6-chloro-2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]-N-(4-hydroxyphenyl)acetamide |
| SMILES | O=C(CN1CCC(N2C(=O)OCc3cc(Cl)ccc32)CC1)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C21H22ClN3O4/c22-15-1-6-19-14(11-15)13-29-21(28)25(19)17-7-9-24(10-8-17)12-20(27)23-16-2-4-18(26)5-3-16/h1-6,11,17,26H,7-10,12-13H2,(H,23,27) |
| InChIKey | OPOPECKVZCAVTO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|