C10H13NO — CID 104824173
[2-(6-methyl-3-pyridinyl)cyclopropyl]methanol (PubChem CID 104824173) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is [2-(6-methyl-3-pyridinyl)cyclopropyl]methanol.
| Compound Name | [2-(6-methyl-3-pyridinyl)cyclopropyl]methanol |
|---|---|
| PubChem CID | 104824173 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | [2-(6-methyl-3-pyridinyl)cyclopropyl]methanol |
| SMILES | Cc1ccc(C2CC2CO)cn1 |
| InChI | InChI=1S/C10H13NO/c1-7-2-3-8(5-11-7)10-4-9(10)6-12/h2-3,5,9-10,12H,4,6H2,1H3 |
| InChIKey | UPMJCMXWOMJOEH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |