C12H16N2O3S — CID 104824487
2-amino-6-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzoic acid (PubChem CID 104824487) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is 2-amino-6-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzoic acid.
| Compound Name | 2-amino-6-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 104824487 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 2-amino-6-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzoic acid |
| SMILES | Nc1cccc(CN2CCS(=O)CC2)c1C(=O)O |
| InChI | InChI=1S/C12H16N2O3S/c13-10-3-1-2-9(11(10)12(15)16)8-14-4-6-18(17)7-5-14/h1-3H,4-8,13H2,(H,15,16) |
| InChIKey | TZVUAWUUICDWBM-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|