2-amino-6-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzoic acid

C12H16N2O3S — CID 104824487

IUPAC2-amino-6-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzoic acid
SMILESNc1cccc(CN2CCS(=O)CC2)c1C(=O)O
InChIInChI=1S/C12H16N2O3S/c13-10-3-1-2-9(11(10)12(15)16)8-14-4-6-18(17)7-5-14/h1-3H,4-8,13H2,(H,15,16)
InChIKeyTZVUAWUUICDWBM-UHFFFAOYSA-N
MW268.34 g/mol
LogP0.53
Rot. Bonds3

About 2-amino-6-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzoic acid

2-amino-6-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzoic acid (PubChem CID 104824487) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is 2-amino-6-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzoic acid.

Molecular Properties

Compound Name2-amino-6-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzoic acid
PubChem CID104824487
Molecular FormulaC12H16N2O3S
Molecular Weight268.34 g/mol
Exact Mass268.09
IUPAC Name2-amino-6-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzoic acid
SMILESNc1cccc(CN2CCS(=O)CC2)c1C(=O)O
InChIInChI=1S/C12H16N2O3S/c13-10-3-1-2-9(11(10)12(15)16)8-14-4-6-18(17)7-5-14/h1-3H,4-8,13H2,(H,15,16)
InChIKeyTZVUAWUUICDWBM-UHFFFAOYSA-N
XLogP0.53
TPSA83.63 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.34
LogP ≤ 50.53
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 2-amino-6-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-6-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzoic acid?
The IUPAC name of 2-amino-6-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzoic acid (CID 104824487) is 2-amino-6-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzoic acid.
What is the SMILES notation for 2-amino-6-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzoic acid?
The canonical SMILES for 2-amino-6-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzoic acid is Nc1cccc(CN2CCS(=O)CC2)c1C(=O)O.
What is the InChIKey of 2-amino-6-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzoic acid?
The InChIKey is TZVUAWUUICDWBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O3S/c13-10-3-1-2-9(11(10)12(15)16)8-14-4-6-18(17)7-5-14/h1-3H,4-8,13H2,(H,15,16).
What are the key properties of 2-amino-6-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzoic acid?
2-amino-6-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzoic acid has a molecular weight of 268.34 g/mol, XLogP of 0.53, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzoic acid is sourced from PubChem (CID 104824487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).