2-amino-6-[(3,4-dimethoxypyrrolidin-1-yl)methyl]benzoic acid

C14H20N2O4 — CID 103531128

IUPAC2-amino-6-[(3,4-dimethoxypyrrolidin-1-yl)methyl]benzoic acid
SMILESCOC1CN(Cc2cccc(N)c2C(=O)O)CC1OC
InChIInChI=1S/C14H20N2O4/c1-19-11-7-16(8-12(11)20-2)6-9-4-3-5-10(15)13(9)14(17)18/h3-5,11-12H,6-8,15H2,1-2H3,(H,17,18)
InChIKeyGLTUVQLKYCLGCA-UHFFFAOYSA-N
MW280.32 g/mol
LogP0.81
Rot. Bonds5

About 2-amino-6-[(3,4-dimethoxypyrrolidin-1-yl)methyl]benzoic acid

2-amino-6-[(3,4-dimethoxypyrrolidin-1-yl)methyl]benzoic acid (PubChem CID 103531128) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-amino-6-[(3,4-dimethoxypyrrolidin-1-yl)methyl]benzoic acid.

Molecular Properties

Compound Name2-amino-6-[(3,4-dimethoxypyrrolidin-1-yl)methyl]benzoic acid
PubChem CID103531128
Molecular FormulaC14H20N2O4
Molecular Weight280.32 g/mol
Exact Mass280.14
IUPAC Name2-amino-6-[(3,4-dimethoxypyrrolidin-1-yl)methyl]benzoic acid
SMILESCOC1CN(Cc2cccc(N)c2C(=O)O)CC1OC
InChIInChI=1S/C14H20N2O4/c1-19-11-7-16(8-12(11)20-2)6-9-4-3-5-10(15)13(9)14(17)18/h3-5,11-12H,6-8,15H2,1-2H3,(H,17,18)
InChIKeyGLTUVQLKYCLGCA-UHFFFAOYSA-N
XLogP0.81
TPSA85.02 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.32
LogP ≤ 50.81
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 2-amino-6-[(3,4-dimethoxypyrrolidin-1-yl)methyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-6-[(3,4-dimethoxypyrrolidin-1-yl)methyl]benzoic acid?
The IUPAC name of 2-amino-6-[(3,4-dimethoxypyrrolidin-1-yl)methyl]benzoic acid (CID 103531128) is 2-amino-6-[(3,4-dimethoxypyrrolidin-1-yl)methyl]benzoic acid.
What is the SMILES notation for 2-amino-6-[(3,4-dimethoxypyrrolidin-1-yl)methyl]benzoic acid?
The canonical SMILES for 2-amino-6-[(3,4-dimethoxypyrrolidin-1-yl)methyl]benzoic acid is COC1CN(Cc2cccc(N)c2C(=O)O)CC1OC.
What is the InChIKey of 2-amino-6-[(3,4-dimethoxypyrrolidin-1-yl)methyl]benzoic acid?
The InChIKey is GLTUVQLKYCLGCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O4/c1-19-11-7-16(8-12(11)20-2)6-9-4-3-5-10(15)13(9)14(17)18/h3-5,11-12H,6-8,15H2,1-2H3,(H,17,18).
What are the key properties of 2-amino-6-[(3,4-dimethoxypyrrolidin-1-yl)methyl]benzoic acid?
2-amino-6-[(3,4-dimethoxypyrrolidin-1-yl)methyl]benzoic acid has a molecular weight of 280.32 g/mol, XLogP of 0.81, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-[(3,4-dimethoxypyrrolidin-1-yl)methyl]benzoic acid is sourced from PubChem (CID 103531128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).