C13H19BrN2O2 — CID 114048541
2-bromo-3-[(3,4-dimethoxypyrrolidin-1-yl)methyl]aniline (PubChem CID 114048541) has the molecular formula C13H19BrN2O2 and a molecular weight of 315.21 g/mol. Its IUPAC name is 2-bromo-3-[(3,4-dimethoxypyrrolidin-1-yl)methyl]aniline.
| Compound Name | 2-bromo-3-[(3,4-dimethoxypyrrolidin-1-yl)methyl]aniline |
|---|---|
| PubChem CID | 114048541 |
| Molecular Formula | C13H19BrN2O2 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 2-bromo-3-[(3,4-dimethoxypyrrolidin-1-yl)methyl]aniline |
| SMILES | COC1CN(Cc2cccc(N)c2Br)CC1OC |
| InChI | InChI=1S/C13H19BrN2O2/c1-17-11-7-16(8-12(11)18-2)6-9-4-3-5-10(15)13(9)14/h3-5,11-12H,6-8,15H2,1-2H3 |
| InChIKey | AYTOSHUYZLDSAZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|