C14H17N3O4 — CID 104825061
methyl 2-amino-6-[(4-methyl-2,5-dioxopiperazin-1-yl)methyl]benzoate (PubChem CID 104825061) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is methyl 2-amino-6-[(4-methyl-2,5-dioxopiperazin-1-yl)methyl]benzoate.
| Compound Name | methyl 2-amino-6-[(4-methyl-2,5-dioxopiperazin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 104825061 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | methyl 2-amino-6-[(4-methyl-2,5-dioxopiperazin-1-yl)methyl]benzoate |
| SMILES | COC(=O)c1c(N)cccc1CN1CC(=O)N(C)CC1=O |
| InChI | InChI=1S/C14H17N3O4/c1-16-7-12(19)17(8-11(16)18)6-9-4-3-5-10(15)13(9)14(20)21-2/h3-5H,6-8,15H2,1-2H3 |
| InChIKey | CRTACMPIBHSROK-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|