C12H12F3NO5 — CID 104825173
2-nitro-6-(4,4,4-trifluorobutoxymethyl)benzoic acid (PubChem CID 104825173) has the molecular formula C12H12F3NO5 and a molecular weight of 307.22 g/mol. Its IUPAC name is 2-nitro-6-(4,4,4-trifluorobutoxymethyl)benzoic acid.
| Compound Name | 2-nitro-6-(4,4,4-trifluorobutoxymethyl)benzoic acid |
|---|---|
| PubChem CID | 104825173 |
| Molecular Formula | C12H12F3NO5 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 2-nitro-6-(4,4,4-trifluorobutoxymethyl)benzoic acid |
| SMILES | O=C(O)c1c(COCCCC(F)(F)F)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12F3NO5/c13-12(14,15)5-2-6-21-7-8-3-1-4-9(16(19)20)10(8)11(17)18/h1,3-4H,2,5-7H2,(H,17,18) |
| InChIKey | MXZLXKHBDRMDOU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|