C10H17N3O2 — CID 104826978
2-[5-(3-aminocyclohexyl)-1,2,4-oxadiazol-3-yl]ethanol (PubChem CID 104826978) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-[5-(3-aminocyclohexyl)-1,2,4-oxadiazol-3-yl]ethanol.
| Compound Name | 2-[5-(3-aminocyclohexyl)-1,2,4-oxadiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 104826978 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 2-[5-(3-aminocyclohexyl)-1,2,4-oxadiazol-3-yl]ethanol |
| SMILES | NC1CCCC(c2nc(CCO)no2)C1 |
| InChI | InChI=1S/C10H17N3O2/c11-8-3-1-2-7(6-8)10-12-9(4-5-14)13-15-10/h7-8,14H,1-6,11H2 |
| InChIKey | FUGBGASVIYKHCE-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |