C14H22N2O3 — CID 104828781
N-(3,3-dimethylbutan-2-yl)-3-ethoxy-5-nitroaniline (PubChem CID 104828781) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-yl)-3-ethoxy-5-nitroaniline.
| Compound Name | N-(3,3-dimethylbutan-2-yl)-3-ethoxy-5-nitroaniline |
|---|---|
| PubChem CID | 104828781 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | N-(3,3-dimethylbutan-2-yl)-3-ethoxy-5-nitroaniline |
| SMILES | CCOc1cc(NC(C)C(C)(C)C)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H22N2O3/c1-6-19-13-8-11(7-12(9-13)16(17)18)15-10(2)14(3,4)5/h7-10,15H,6H2,1-5H3 |
| InChIKey | MZMURCOWJRTXQW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|