3-(3-ethoxy-5-nitroanilino)-2,2-dimethylpropanoic acid

C13H18N2O5 — CID 115427662

IUPAC3-(3-ethoxy-5-nitroanilino)-2,2-dimethylpropanoic acid
SMILESCCOc1cc(NCC(C)(C)C(=O)O)cc([N+](=O)[O-])c1
InChIInChI=1S/C13H18N2O5/c1-4-20-11-6-9(5-10(7-11)15(18)19)14-8-13(2,3)12(16)17/h5-7,14H,4,8H2,1-3H3,(H,16,17)
InChIKeyPHAFEKUVEHVTHA-UHFFFAOYSA-N
MW282.30 g/mol
LogP2.52
Rot. Bonds7

About 3-(3-ethoxy-5-nitroanilino)-2,2-dimethylpropanoic acid

3-(3-ethoxy-5-nitroanilino)-2,2-dimethylpropanoic acid (PubChem CID 115427662) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is 3-(3-ethoxy-5-nitroanilino)-2,2-dimethylpropanoic acid.

Molecular Properties

Compound Name3-(3-ethoxy-5-nitroanilino)-2,2-dimethylpropanoic acid
PubChem CID115427662
Molecular FormulaC13H18N2O5
Molecular Weight282.30 g/mol
Exact Mass282.12
IUPAC Name3-(3-ethoxy-5-nitroanilino)-2,2-dimethylpropanoic acid
SMILESCCOc1cc(NCC(C)(C)C(=O)O)cc([N+](=O)[O-])c1
InChIInChI=1S/C13H18N2O5/c1-4-20-11-6-9(5-10(7-11)15(18)19)14-8-13(2,3)12(16)17/h5-7,14H,4,8H2,1-3H3,(H,16,17)
InChIKeyPHAFEKUVEHVTHA-UHFFFAOYSA-N
XLogP2.52
TPSA101.70 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.30
LogP ≤ 52.52
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 3-(3-ethoxy-5-nitroanilino)-2,2-dimethylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3-ethoxy-5-nitroanilino)-2,2-dimethylpropanoic acid?
The IUPAC name of 3-(3-ethoxy-5-nitroanilino)-2,2-dimethylpropanoic acid (CID 115427662) is 3-(3-ethoxy-5-nitroanilino)-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-(3-ethoxy-5-nitroanilino)-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-(3-ethoxy-5-nitroanilino)-2,2-dimethylpropanoic acid is CCOc1cc(NCC(C)(C)C(=O)O)cc([N+](=O)[O-])c1.
What is the InChIKey of 3-(3-ethoxy-5-nitroanilino)-2,2-dimethylpropanoic acid?
The InChIKey is PHAFEKUVEHVTHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O5/c1-4-20-11-6-9(5-10(7-11)15(18)19)14-8-13(2,3)12(16)17/h5-7,14H,4,8H2,1-3H3,(H,16,17).
What are the key properties of 3-(3-ethoxy-5-nitroanilino)-2,2-dimethylpropanoic acid?
3-(3-ethoxy-5-nitroanilino)-2,2-dimethylpropanoic acid has a molecular weight of 282.30 g/mol, XLogP of 2.52, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-ethoxy-5-nitroanilino)-2,2-dimethylpropanoic acid is sourced from PubChem (CID 115427662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).