C16H20FNO3 — CID 104829771
(E)-3-[3-(3,3-dimethylbutan-2-ylcarbamoyl)-4-fluorophenyl]prop-2-enoic acid (PubChem CID 104829771) has the molecular formula C16H20FNO3 and a molecular weight of 293.34 g/mol. Its IUPAC name is (E)-3-[3-(3,3-dimethylbutan-2-ylcarbamoyl)-4-fluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-(3,3-dimethylbutan-2-ylcarbamoyl)-4-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 104829771 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (E)-3-[3-(3,3-dimethylbutan-2-ylcarbamoyl)-4-fluorophenyl]prop-2-enoic acid |
| SMILES | CC(NC(=O)c1cc(/C=C/C(=O)O)ccc1F)C(C)(C)C |
| InChI | InChI=1S/C16H20FNO3/c1-10(16(2,3)4)18-15(21)12-9-11(5-7-13(12)17)6-8-14(19)20/h5-10H,1-4H3,(H,18,21)(H,19,20)/b8-6+ |
| InChIKey | SLFFVVHATPQUNY-SOFGYWHQSA-N |
| XLogP | 3.09 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|