C14H15FN2O4 — CID 76907046
3-[4-fluoro-3-[[1-(methylamino)-1-oxopropan-2-yl]carbamoyl]phenyl]prop-2-enoic acid (PubChem CID 76907046) has the molecular formula C14H15FN2O4 and a molecular weight of 294.28 g/mol. Its IUPAC name is 3-[4-fluoro-3-[[1-(methylamino)-1-oxopropan-2-yl]carbamoyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-fluoro-3-[[1-(methylamino)-1-oxopropan-2-yl]carbamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76907046 |
| Molecular Formula | C14H15FN2O4 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 3-[4-fluoro-3-[[1-(methylamino)-1-oxopropan-2-yl]carbamoyl]phenyl]prop-2-enoic acid |
| SMILES | CNC(=O)C(C)NC(=O)c1cc(C=CC(=O)O)ccc1F |
| InChI | InChI=1S/C14H15FN2O4/c1-8(13(20)16-2)17-14(21)10-7-9(3-5-11(10)15)4-6-12(18)19/h3-8H,1-2H3,(H,16,20)(H,17,21)(H,18,19) |
| InChIKey | XZWAZVBKNNZSKJ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|