C9H7F2NO2 — CID 104830900
(E)-2-amino-3-(2,5-difluorophenyl)prop-2-enoic acid (PubChem CID 104830900) has the molecular formula C9H7F2NO2 and a molecular weight of 199.16 g/mol. Its IUPAC name is (E)-2-amino-3-(2,5-difluorophenyl)prop-2-enoic acid.
| Compound Name | (E)-2-amino-3-(2,5-difluorophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 104830900 |
| Molecular Formula | C9H7F2NO2 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | (E)-2-amino-3-(2,5-difluorophenyl)prop-2-enoic acid |
| SMILES | N/C(=C/c1cc(F)ccc1F)C(=O)O |
| InChI | InChI=1S/C9H7F2NO2/c10-6-1-2-7(11)5(3-6)4-8(12)9(13)14/h1-4H,12H2,(H,13,14)/b8-4+ |
| InChIKey | CBFBNDFJCWZPET-XBXARRHUSA-N |
| XLogP | 1.35 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|