C12H14FNO4 — CID 104832503
3-(2-fluoro-6-nitrophenoxy)-2,2-dimethylcyclobutan-1-ol (PubChem CID 104832503) has the molecular formula C12H14FNO4 and a molecular weight of 255.24 g/mol. Its IUPAC name is 3-(2-fluoro-6-nitrophenoxy)-2,2-dimethylcyclobutan-1-ol.
| Compound Name | 3-(2-fluoro-6-nitrophenoxy)-2,2-dimethylcyclobutan-1-ol |
|---|---|
| PubChem CID | 104832503 |
| Molecular Formula | C12H14FNO4 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 3-(2-fluoro-6-nitrophenoxy)-2,2-dimethylcyclobutan-1-ol |
| SMILES | CC1(C)C(O)CC1Oc1c(F)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14FNO4/c1-12(2)9(15)6-10(12)18-11-7(13)4-3-5-8(11)14(16)17/h3-5,9-10,15H,6H2,1-2H3 |
| InChIKey | BMRUCEABSQYLEO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|