C12H13BrFNO4 — CID 66345836
3-(2-bromo-4-fluoro-6-nitrophenoxy)-2,2-dimethylcyclobutan-1-ol (PubChem CID 66345836) has the molecular formula C12H13BrFNO4 and a molecular weight of 334.14 g/mol. Its IUPAC name is 3-(2-bromo-4-fluoro-6-nitrophenoxy)-2,2-dimethylcyclobutan-1-ol.
| Compound Name | 3-(2-bromo-4-fluoro-6-nitrophenoxy)-2,2-dimethylcyclobutan-1-ol |
|---|---|
| PubChem CID | 66345836 |
| Molecular Formula | C12H13BrFNO4 |
| Molecular Weight | 334.14 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 3-(2-bromo-4-fluoro-6-nitrophenoxy)-2,2-dimethylcyclobutan-1-ol |
| SMILES | CC1(C)C(O)CC1Oc1c(Br)cc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13BrFNO4/c1-12(2)9(16)5-10(12)19-11-7(13)3-6(14)4-8(11)15(17)18/h3-4,9-10,16H,5H2,1-2H3 |
| InChIKey | ILLNHXDCYPHICJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.14 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|