C11H11NO4 — CID 104832805
3-(cyclopropanecarbonylamino)-2-hydroxybenzoic acid (PubChem CID 104832805) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is 3-(cyclopropanecarbonylamino)-2-hydroxybenzoic acid.
| Compound Name | 3-(cyclopropanecarbonylamino)-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 104832805 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 3-(cyclopropanecarbonylamino)-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cccc(NC(=O)C2CC2)c1O |
| InChI | InChI=1S/C11H11NO4/c13-9-7(11(15)16)2-1-3-8(9)12-10(14)6-4-5-6/h1-3,6,13H,4-5H2,(H,12,14)(H,15,16) |
| InChIKey | BCTFCCYOTPHFLS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|