C13H16N2O5 — CID 104833689
2-hydroxy-3-(1,4-oxazepane-4-carbonylamino)benzoic acid (PubChem CID 104833689) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-hydroxy-3-(1,4-oxazepane-4-carbonylamino)benzoic acid.
| Compound Name | 2-hydroxy-3-(1,4-oxazepane-4-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 104833689 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-hydroxy-3-(1,4-oxazepane-4-carbonylamino)benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=O)N2CCCOCC2)c1O |
| InChI | InChI=1S/C13H16N2O5/c16-11-9(12(17)18)3-1-4-10(11)14-13(19)15-5-2-7-20-8-6-15/h1,3-4,16H,2,5-8H2,(H,14,19)(H,17,18) |
| InChIKey | GAYZGCMUQWCFNQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|