2-chloro-4-(1,4-oxazepane-4-carbonylamino)benzoic acid

C13H15ClN2O4 — CID 62968868

IUPAC2-chloro-4-(1,4-oxazepane-4-carbonylamino)benzoic acid
SMILESO=C(O)c1ccc(NC(=O)N2CCCOCC2)cc1Cl
InChIInChI=1S/C13H15ClN2O4/c14-11-8-9(2-3-10(11)12(17)18)15-13(19)16-4-1-6-20-7-5-16/h2-3,8H,1,4-7H2,(H,15,19)(H,17,18)
InChIKeyYAUJNIZNPLZGDJ-UHFFFAOYSA-N
MW298.73 g/mol
LogP2.29
Rot. Bonds2

About 2-chloro-4-(1,4-oxazepane-4-carbonylamino)benzoic acid

2-chloro-4-(1,4-oxazepane-4-carbonylamino)benzoic acid (PubChem CID 62968868) has the molecular formula C13H15ClN2O4 and a molecular weight of 298.73 g/mol. Its IUPAC name is 2-chloro-4-(1,4-oxazepane-4-carbonylamino)benzoic acid.

Molecular Properties

Compound Name2-chloro-4-(1,4-oxazepane-4-carbonylamino)benzoic acid
PubChem CID62968868
Molecular FormulaC13H15ClN2O4
Molecular Weight298.73 g/mol
Exact Mass298.07
IUPAC Name2-chloro-4-(1,4-oxazepane-4-carbonylamino)benzoic acid
SMILESO=C(O)c1ccc(NC(=O)N2CCCOCC2)cc1Cl
InChIInChI=1S/C13H15ClN2O4/c14-11-8-9(2-3-10(11)12(17)18)15-13(19)16-4-1-6-20-7-5-16/h2-3,8H,1,4-7H2,(H,15,19)(H,17,18)
InChIKeyYAUJNIZNPLZGDJ-UHFFFAOYSA-N
XLogP2.29
TPSA78.87 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.73
LogP ≤ 52.29
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-chloro-4-(1,4-oxazepane-4-carbonylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-chloro-4-(1,4-oxazepane-4-carbonylamino)benzoic acid?
The IUPAC name of 2-chloro-4-(1,4-oxazepane-4-carbonylamino)benzoic acid (CID 62968868) is 2-chloro-4-(1,4-oxazepane-4-carbonylamino)benzoic acid.
What is the SMILES notation for 2-chloro-4-(1,4-oxazepane-4-carbonylamino)benzoic acid?
The canonical SMILES for 2-chloro-4-(1,4-oxazepane-4-carbonylamino)benzoic acid is O=C(O)c1ccc(NC(=O)N2CCCOCC2)cc1Cl.
What is the InChIKey of 2-chloro-4-(1,4-oxazepane-4-carbonylamino)benzoic acid?
The InChIKey is YAUJNIZNPLZGDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClN2O4/c14-11-8-9(2-3-10(11)12(17)18)15-13(19)16-4-1-6-20-7-5-16/h2-3,8H,1,4-7H2,(H,15,19)(H,17,18).
What are the key properties of 2-chloro-4-(1,4-oxazepane-4-carbonylamino)benzoic acid?
2-chloro-4-(1,4-oxazepane-4-carbonylamino)benzoic acid has a molecular weight of 298.73 g/mol, XLogP of 2.29, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(1,4-oxazepane-4-carbonylamino)benzoic acid is sourced from PubChem (CID 62968868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).