C13H15ClN2O3S — CID 61423625
2-chloro-5-(1,4-thiazepane-4-carbonylamino)benzoic acid (PubChem CID 61423625) has the molecular formula C13H15ClN2O3S and a molecular weight of 314.79 g/mol. Its IUPAC name is 2-chloro-5-(1,4-thiazepane-4-carbonylamino)benzoic acid.
| Compound Name | 2-chloro-5-(1,4-thiazepane-4-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 61423625 |
| Molecular Formula | C13H15ClN2O3S |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 2-chloro-5-(1,4-thiazepane-4-carbonylamino)benzoic acid |
| SMILES | O=C(O)c1cc(NC(=O)N2CCCSCC2)ccc1Cl |
| InChI | InChI=1S/C13H15ClN2O3S/c14-11-3-2-9(8-10(11)12(17)18)15-13(19)16-4-1-6-20-7-5-16/h2-3,8H,1,4-7H2,(H,15,19)(H,17,18) |
| InChIKey | IXRAYDPUHBTJTH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |