C14H18ClN3O3 — CID 61193508
2-chloro-5-[(4-methyl-1,4-diazepane-1-carbonyl)amino]benzoic acid (PubChem CID 61193508) has the molecular formula C14H18ClN3O3 and a molecular weight of 311.77 g/mol. Its IUPAC name is 2-chloro-5-[(4-methyl-1,4-diazepane-1-carbonyl)amino]benzoic acid.
| Compound Name | 2-chloro-5-[(4-methyl-1,4-diazepane-1-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 61193508 |
| Molecular Formula | C14H18ClN3O3 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 2-chloro-5-[(4-methyl-1,4-diazepane-1-carbonyl)amino]benzoic acid |
| SMILES | CN1CCCN(C(=O)Nc2ccc(Cl)c(C(=O)O)c2)CC1 |
| InChI | InChI=1S/C14H18ClN3O3/c1-17-5-2-6-18(8-7-17)14(21)16-10-3-4-12(15)11(9-10)13(19)20/h3-4,9H,2,5-8H2,1H3,(H,16,21)(H,19,20) |
| InChIKey | BEUGCFOPDSIXRP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |