C13H14ClN3O4 — CID 65363999
2-chloro-5-[(3-oxo-1,4-diazepane-1-carbonyl)amino]benzoic acid (PubChem CID 65363999) has the molecular formula C13H14ClN3O4 and a molecular weight of 311.73 g/mol. Its IUPAC name is 2-chloro-5-[(3-oxo-1,4-diazepane-1-carbonyl)amino]benzoic acid.
| Compound Name | 2-chloro-5-[(3-oxo-1,4-diazepane-1-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 65363999 |
| Molecular Formula | C13H14ClN3O4 |
| Molecular Weight | 311.73 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-chloro-5-[(3-oxo-1,4-diazepane-1-carbonyl)amino]benzoic acid |
| SMILES | O=C1CN(C(=O)Nc2ccc(Cl)c(C(=O)O)c2)CCCN1 |
| InChI | InChI=1S/C13H14ClN3O4/c14-10-3-2-8(6-9(10)12(19)20)16-13(21)17-5-1-4-15-11(18)7-17/h2-3,6H,1,4-5,7H2,(H,15,18)(H,16,21)(H,19,20) |
| InChIKey | IHOIOGBHQZKQSI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.73 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |