2-methyl-4-[(5-oxo-1,4-diazepane-1-carbonyl)amino]benzoic acid

C14H17N3O4 — CID 63003774

IUPAC2-methyl-4-[(5-oxo-1,4-diazepane-1-carbonyl)amino]benzoic acid
SMILESCc1cc(NC(=O)N2CCNC(=O)CC2)ccc1C(=O)O
InChIInChI=1S/C14H17N3O4/c1-9-8-10(2-3-11(9)13(19)20)16-14(21)17-6-4-12(18)15-5-7-17/h2-3,8H,4-7H2,1H3,(H,15,18)(H,16,21)(H,19,20)
InChIKeyXNHFWBQYPAATPM-UHFFFAOYSA-N
MW291.31 g/mol
LogP1.05
Rot. Bonds2

About 2-methyl-4-[(5-oxo-1,4-diazepane-1-carbonyl)amino]benzoic acid

2-methyl-4-[(5-oxo-1,4-diazepane-1-carbonyl)amino]benzoic acid (PubChem CID 63003774) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-methyl-4-[(5-oxo-1,4-diazepane-1-carbonyl)amino]benzoic acid.

Molecular Properties

Compound Name2-methyl-4-[(5-oxo-1,4-diazepane-1-carbonyl)amino]benzoic acid
PubChem CID63003774
Molecular FormulaC14H17N3O4
Molecular Weight291.31 g/mol
Exact Mass291.12
IUPAC Name2-methyl-4-[(5-oxo-1,4-diazepane-1-carbonyl)amino]benzoic acid
SMILESCc1cc(NC(=O)N2CCNC(=O)CC2)ccc1C(=O)O
InChIInChI=1S/C14H17N3O4/c1-9-8-10(2-3-11(9)13(19)20)16-14(21)17-6-4-12(18)15-5-7-17/h2-3,8H,4-7H2,1H3,(H,15,18)(H,16,21)(H,19,20)
InChIKeyXNHFWBQYPAATPM-UHFFFAOYSA-N
XLogP1.05
TPSA98.74 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.31
LogP ≤ 51.05
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-methyl-4-[(5-oxo-1,4-diazepane-1-carbonyl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-4-[(5-oxo-1,4-diazepane-1-carbonyl)amino]benzoic acid?
The IUPAC name of 2-methyl-4-[(5-oxo-1,4-diazepane-1-carbonyl)amino]benzoic acid (CID 63003774) is 2-methyl-4-[(5-oxo-1,4-diazepane-1-carbonyl)amino]benzoic acid.
What is the SMILES notation for 2-methyl-4-[(5-oxo-1,4-diazepane-1-carbonyl)amino]benzoic acid?
The canonical SMILES for 2-methyl-4-[(5-oxo-1,4-diazepane-1-carbonyl)amino]benzoic acid is Cc1cc(NC(=O)N2CCNC(=O)CC2)ccc1C(=O)O.
What is the InChIKey of 2-methyl-4-[(5-oxo-1,4-diazepane-1-carbonyl)amino]benzoic acid?
The InChIKey is XNHFWBQYPAATPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O4/c1-9-8-10(2-3-11(9)13(19)20)16-14(21)17-6-4-12(18)15-5-7-17/h2-3,8H,4-7H2,1H3,(H,15,18)(H,16,21)(H,19,20).
What are the key properties of 2-methyl-4-[(5-oxo-1,4-diazepane-1-carbonyl)amino]benzoic acid?
2-methyl-4-[(5-oxo-1,4-diazepane-1-carbonyl)amino]benzoic acid has a molecular weight of 291.31 g/mol, XLogP of 1.05, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-[(5-oxo-1,4-diazepane-1-carbonyl)amino]benzoic acid is sourced from PubChem (CID 63003774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).