C12H14N4O4 — CID 60706130
N-(4-nitrophenyl)-5-oxo-1,4-diazepane-1-carboxamide (PubChem CID 60706130) has the molecular formula C12H14N4O4 and a molecular weight of 278.27 g/mol. Its IUPAC name is N-(4-nitrophenyl)-5-oxo-1,4-diazepane-1-carboxamide.
| Compound Name | N-(4-nitrophenyl)-5-oxo-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 60706130 |
| Molecular Formula | C12H14N4O4 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | N-(4-nitrophenyl)-5-oxo-1,4-diazepane-1-carboxamide |
| SMILES | O=C1CCN(C(=O)Nc2ccc([N+](=O)[O-])cc2)CCN1 |
| InChI | InChI=1S/C12H14N4O4/c17-11-5-7-15(8-6-13-11)12(18)14-9-1-3-10(4-2-9)16(19)20/h1-4H,5-8H2,(H,13,17)(H,14,18) |
| InChIKey | MYXBSTXKHKNPQS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|