C13H17Br2N3O — CID 68996350
N-(3,5-dibromophenyl)-4-methyl-1,4-diazepane-1-carboxamide (PubChem CID 68996350) has the molecular formula C13H17Br2N3O and a molecular weight of 391.11 g/mol. Its IUPAC name is N-(3,5-dibromophenyl)-4-methyl-1,4-diazepane-1-carboxamide.
| Compound Name | N-(3,5-dibromophenyl)-4-methyl-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 68996350 |
| Molecular Formula | C13H17Br2N3O |
| Molecular Weight | 391.11 g/mol |
| Exact Mass | 388.97 |
| IUPAC Name | N-(3,5-dibromophenyl)-4-methyl-1,4-diazepane-1-carboxamide |
| SMILES | CN1CCCN(C(=O)Nc2cc(Br)cc(Br)c2)CC1 |
| InChI | InChI=1S/C13H17Br2N3O/c1-17-3-2-4-18(6-5-17)13(19)16-12-8-10(14)7-11(15)9-12/h7-9H,2-6H2,1H3,(H,16,19) |
| InChIKey | LRRDNYMONXLJIS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.11 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |