C16H14ClNO3 — CID 104835398
6-(3-chloro-2-nitrophenoxy)-1,2,3,4-tetrahydronaphthalene (PubChem CID 104835398) has the molecular formula C16H14ClNO3 and a molecular weight of 303.75 g/mol. Its IUPAC name is 6-(3-chloro-2-nitrophenoxy)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-(3-chloro-2-nitrophenoxy)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 104835398 |
| Molecular Formula | C16H14ClNO3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 6-(3-chloro-2-nitrophenoxy)-1,2,3,4-tetrahydronaphthalene |
| SMILES | O=[N+]([O-])c1c(Cl)cccc1Oc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C16H14ClNO3/c17-14-6-3-7-15(16(14)18(19)20)21-13-9-8-11-4-1-2-5-12(11)10-13/h3,6-10H,1-2,4-5H2 |
| InChIKey | UEWXPKGKPNLXLO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|