C13H7ClF2N2S — CID 104836216
7-chloro-3-(2,6-difluorophenyl)-1H-benzimidazole-2-thione (PubChem CID 104836216) has the molecular formula C13H7ClF2N2S and a molecular weight of 296.73 g/mol. Its IUPAC name is 7-chloro-3-(2,6-difluorophenyl)-1H-benzimidazole-2-thione.
| Compound Name | 7-chloro-3-(2,6-difluorophenyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 104836216 |
| Molecular Formula | C13H7ClF2N2S |
| Molecular Weight | 296.73 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 7-chloro-3-(2,6-difluorophenyl)-1H-benzimidazole-2-thione |
| SMILES | Fc1cccc(F)c1-n1c(=S)[nH]c2c(Cl)cccc21 |
| InChI | InChI=1S/C13H7ClF2N2S/c14-7-3-1-6-10-11(7)17-13(19)18(10)12-8(15)4-2-5-9(12)16/h1-6H,(H,17,19) |
| InChIKey | WVUMDVKWENUMHW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.73 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|