C13H7Br2ClN2S — CID 107601261
7-chloro-3-(2,6-dibromophenyl)-1H-benzimidazole-2-thione (PubChem CID 107601261) has the molecular formula C13H7Br2ClN2S and a molecular weight of 418.54 g/mol. Its IUPAC name is 7-chloro-3-(2,6-dibromophenyl)-1H-benzimidazole-2-thione.
| Compound Name | 7-chloro-3-(2,6-dibromophenyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 107601261 |
| Molecular Formula | C13H7Br2ClN2S |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 415.84 |
| IUPAC Name | 7-chloro-3-(2,6-dibromophenyl)-1H-benzimidazole-2-thione |
| SMILES | S=c1[nH]c2c(Cl)cccc2n1-c1c(Br)cccc1Br |
| InChI | InChI=1S/C13H7Br2ClN2S/c14-7-3-1-4-8(15)12(7)18-10-6-2-5-9(16)11(10)17-13(18)19/h1-6H,(H,17,19) |
| InChIKey | QEAXKUJGLYDADJ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|