C14H19ClN4S — CID 104836493
7-chloro-3-[(1,4-dimethylpiperazin-2-yl)methyl]-1H-benzimidazole-2-thione (PubChem CID 104836493) has the molecular formula C14H19ClN4S and a molecular weight of 310.85 g/mol. Its IUPAC name is 7-chloro-3-[(1,4-dimethylpiperazin-2-yl)methyl]-1H-benzimidazole-2-thione.
| Compound Name | 7-chloro-3-[(1,4-dimethylpiperazin-2-yl)methyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 104836493 |
| Molecular Formula | C14H19ClN4S |
| Molecular Weight | 310.85 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 7-chloro-3-[(1,4-dimethylpiperazin-2-yl)methyl]-1H-benzimidazole-2-thione |
| SMILES | CN1CCN(C)C(Cn2c(=S)[nH]c3c(Cl)cccc32)C1 |
| InChI | InChI=1S/C14H19ClN4S/c1-17-6-7-18(2)10(8-17)9-19-12-5-3-4-11(15)13(12)16-14(19)20/h3-5,10H,6-9H2,1-2H3,(H,16,20) |
| InChIKey | VLNSZSDNBWELJC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 27.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.85 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|