C11H20N4S — CID 81336213
3-[(1,4-dimethylpiperazin-2-yl)methyl]-5-methyl-1H-imidazole-2-thione (PubChem CID 81336213) has the molecular formula C11H20N4S and a molecular weight of 240.38 g/mol. Its IUPAC name is 3-[(1,4-dimethylpiperazin-2-yl)methyl]-5-methyl-1H-imidazole-2-thione.
| Compound Name | 3-[(1,4-dimethylpiperazin-2-yl)methyl]-5-methyl-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 81336213 |
| Molecular Formula | C11H20N4S |
| Molecular Weight | 240.38 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 3-[(1,4-dimethylpiperazin-2-yl)methyl]-5-methyl-1H-imidazole-2-thione |
| SMILES | Cc1cn(CC2CN(C)CCN2C)c(=S)[nH]1 |
| InChI | InChI=1S/C11H20N4S/c1-9-6-15(11(16)12-9)8-10-7-13(2)4-5-14(10)3/h6,10H,4-5,7-8H2,1-3H3,(H,12,16) |
| InChIKey | TXTDIQWODMQZPV-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 27.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|