C14H11ClN2O2S2 — CID 104836732
2-[4-chloro-1-(thiophen-3-ylmethyl)benzimidazol-2-yl]sulfanylacetic acid (PubChem CID 104836732) has the molecular formula C14H11ClN2O2S2 and a molecular weight of 338.84 g/mol. Its IUPAC name is 2-[4-chloro-1-(thiophen-3-ylmethyl)benzimidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[4-chloro-1-(thiophen-3-ylmethyl)benzimidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 104836732 |
| Molecular Formula | C14H11ClN2O2S2 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | 2-[4-chloro-1-(thiophen-3-ylmethyl)benzimidazol-2-yl]sulfanylacetic acid |
| SMILES | O=C(O)CSc1nc2c(Cl)cccc2n1Cc1ccsc1 |
| InChI | InChI=1S/C14H11ClN2O2S2/c15-10-2-1-3-11-13(10)16-14(21-8-12(18)19)17(11)6-9-4-5-20-7-9/h1-5,7H,6,8H2,(H,18,19) |
| InChIKey | IXBFGXKWPIOJHW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |