C14H15ClN2O3S — CID 104836668
2-[4-chloro-1-(oxolan-2-ylmethyl)benzimidazol-2-yl]sulfanylacetic acid (PubChem CID 104836668) has the molecular formula C14H15ClN2O3S and a molecular weight of 326.81 g/mol. Its IUPAC name is 2-[4-chloro-1-(oxolan-2-ylmethyl)benzimidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[4-chloro-1-(oxolan-2-ylmethyl)benzimidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 104836668 |
| Molecular Formula | C14H15ClN2O3S |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 2-[4-chloro-1-(oxolan-2-ylmethyl)benzimidazol-2-yl]sulfanylacetic acid |
| SMILES | O=C(O)CSc1nc2c(Cl)cccc2n1CC1CCCO1 |
| InChI | InChI=1S/C14H15ClN2O3S/c15-10-4-1-5-11-13(10)16-14(21-8-12(18)19)17(11)7-9-3-2-6-20-9/h1,4-5,9H,2-3,6-8H2,(H,18,19) |
| InChIKey | NGMFHDLLIYBJPC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |