C14H22N2O3S — CID 81336662
2-[5-tert-butyl-1-(oxolan-2-ylmethyl)imidazol-2-yl]sulfanylacetic acid (PubChem CID 81336662) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 2-[5-tert-butyl-1-(oxolan-2-ylmethyl)imidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[5-tert-butyl-1-(oxolan-2-ylmethyl)imidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 81336662 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2-[5-tert-butyl-1-(oxolan-2-ylmethyl)imidazol-2-yl]sulfanylacetic acid |
| SMILES | CC(C)(C)c1cnc(SCC(=O)O)n1CC1CCCO1 |
| InChI | InChI=1S/C14H22N2O3S/c1-14(2,3)11-7-15-13(20-9-12(17)18)16(11)8-10-5-4-6-19-10/h7,10H,4-6,8-9H2,1-3H3,(H,17,18) |
| InChIKey | RDYZXAOBDXXWPB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |