C14H16Cl2N2O2S — CID 104837955
3-[4-chloro-2-(1-chloroethyl)benzimidazol-1-yl]-3-methylthiolane 1,1-dioxide (PubChem CID 104837955) has the molecular formula C14H16Cl2N2O2S and a molecular weight of 347.27 g/mol. Its IUPAC name is 3-[4-chloro-2-(1-chloroethyl)benzimidazol-1-yl]-3-methylthiolane 1,1-dioxide.
| Compound Name | 3-[4-chloro-2-(1-chloroethyl)benzimidazol-1-yl]-3-methylthiolane 1,1-dioxide |
|---|---|
| PubChem CID | 104837955 |
| Molecular Formula | C14H16Cl2N2O2S |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 3-[4-chloro-2-(1-chloroethyl)benzimidazol-1-yl]-3-methylthiolane 1,1-dioxide |
| SMILES | CC(Cl)c1nc2c(Cl)cccc2n1C1(C)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H16Cl2N2O2S/c1-9(15)13-17-12-10(16)4-3-5-11(12)18(13)14(2)6-7-21(19,20)8-14/h3-5,9H,6-8H2,1-2H3 |
| InChIKey | JOVKQMIHBBKXLE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|