C16H20Cl2N2 — CID 104838303
4-chloro-2-(chloromethyl)-1-(3-ethyl-2-methylcyclopentyl)benzimidazole (PubChem CID 104838303) has the molecular formula C16H20Cl2N2 and a molecular weight of 311.26 g/mol. Its IUPAC name is 4-chloro-2-(chloromethyl)-1-(3-ethyl-2-methylcyclopentyl)benzimidazole.
| Compound Name | 4-chloro-2-(chloromethyl)-1-(3-ethyl-2-methylcyclopentyl)benzimidazole |
|---|---|
| PubChem CID | 104838303 |
| Molecular Formula | C16H20Cl2N2 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 4-chloro-2-(chloromethyl)-1-(3-ethyl-2-methylcyclopentyl)benzimidazole |
| SMILES | CCC1CCC(n2c(CCl)nc3c(Cl)cccc32)C1C |
| InChI | InChI=1S/C16H20Cl2N2/c1-3-11-7-8-13(10(11)2)20-14-6-4-5-12(18)16(14)19-15(20)9-17/h4-6,10-11,13H,3,7-9H2,1-2H3 |
| InChIKey | ZPTSIRVCMINNAP-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|