C14H11BrCl2N2S — CID 104838494
1-[(3-bromothiophen-2-yl)methyl]-4-chloro-2-(2-chloroethyl)benzimidazole (PubChem CID 104838494) has the molecular formula C14H11BrCl2N2S and a molecular weight of 390.13 g/mol. Its IUPAC name is 1-[(3-bromothiophen-2-yl)methyl]-4-chloro-2-(2-chloroethyl)benzimidazole.
| Compound Name | 1-[(3-bromothiophen-2-yl)methyl]-4-chloro-2-(2-chloroethyl)benzimidazole |
|---|---|
| PubChem CID | 104838494 |
| Molecular Formula | C14H11BrCl2N2S |
| Molecular Weight | 390.13 g/mol |
| Exact Mass | 387.92 |
| IUPAC Name | 1-[(3-bromothiophen-2-yl)methyl]-4-chloro-2-(2-chloroethyl)benzimidazole |
| SMILES | ClCCc1nc2c(Cl)cccc2n1Cc1sccc1Br |
| InChI | InChI=1S/C14H11BrCl2N2S/c15-9-5-7-20-12(9)8-19-11-3-1-2-10(17)14(11)18-13(19)4-6-16/h1-3,5,7H,4,6,8H2 |
| InChIKey | TYPZNJTZISSVHF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.13 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|