About 1-(3-chloro-2-nitrophenyl)-2,5-diethylpiperazine
1-(3-chloro-2-nitrophenyl)-2,5-diethylpiperazine (PubChem CID 104839384) has the molecular formula C14H20ClN3O2
and a molecular weight of 297.79 g/mol. Its IUPAC name is 1-(3-chloro-2-nitrophenyl)-2,5-diethylpiperazine.
Molecular Properties
| Compound Name | 1-(3-chloro-2-nitrophenyl)-2,5-diethylpiperazine |
| PubChem CID | 104839384 |
| Molecular Formula | C14H20ClN3O2 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 1-(3-chloro-2-nitrophenyl)-2,5-diethylpiperazine |
| SMILES | CCC1CN(c2cccc(Cl)c2[N+](=O)[O-])C(CC)CN1 |
| InChI | InChI=1S/C14H20ClN3O2/c1-3-10-9-17(11(4-2)8-16-10)13-7-5-6-12(15)14(13)18(19)20/h5-7,10-11,16H,3-4,8-9H2,1-2H3 |
| InChIKey | QBOOABMCMBXNNK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-chloro-2-nitrophenyl)-2,5-diethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloro-2-nitrophenyl)-2,5-diethylpiperazine?
The IUPAC name of 1-(3-chloro-2-nitrophenyl)-2,5-diethylpiperazine (CID 104839384) is 1-(3-chloro-2-nitrophenyl)-2,5-diethylpiperazine.
What is the SMILES notation for 1-(3-chloro-2-nitrophenyl)-2,5-diethylpiperazine?
The canonical SMILES for 1-(3-chloro-2-nitrophenyl)-2,5-diethylpiperazine is CCC1CN(c2cccc(Cl)c2[N+](=O)[O-])C(CC)CN1.
What is the InChIKey of 1-(3-chloro-2-nitrophenyl)-2,5-diethylpiperazine?
The InChIKey is QBOOABMCMBXNNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClN3O2/c1-3-10-9-17(11(4-2)8-16-10)13-7-5-6-12(15)14(13)18(19)20/h5-7,10-11,16H,3-4,8-9H2,1-2H3.
What are the key properties of 1-(3-chloro-2-nitrophenyl)-2,5-diethylpiperazine?
1-(3-chloro-2-nitrophenyl)-2,5-diethylpiperazine has a molecular weight of 297.79 g/mol, XLogP of 3.21, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloro-2-nitrophenyl)-2,5-diethylpiperazine is sourced from PubChem (CID 104839384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).