About 6-chloro-1-ethyl-3-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one
6-chloro-1-ethyl-3-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one (PubChem CID 104839614) has the molecular formula C12H15ClN2O
and a molecular weight of 238.72 g/mol. Its IUPAC name is 6-chloro-1-ethyl-3-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one.
Molecular Properties
| Compound Name | 6-chloro-1-ethyl-3-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one |
| PubChem CID | 104839614 |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 6-chloro-1-ethyl-3-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one |
| SMILES | CCN1CC(C)C(=O)Nc2c(Cl)cccc21 |
| InChI | InChI=1S/C12H15ClN2O/c1-3-15-7-8(2)12(16)14-11-9(13)5-4-6-10(11)15/h4-6,8H,3,7H2,1-2H3,(H,14,16) |
| InChIKey | PTVYRVALOOBYNY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-1-ethyl-3-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1-ethyl-3-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one?
The IUPAC name of 6-chloro-1-ethyl-3-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one (CID 104839614) is 6-chloro-1-ethyl-3-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one.
What is the SMILES notation for 6-chloro-1-ethyl-3-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one?
The canonical SMILES for 6-chloro-1-ethyl-3-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one is CCN1CC(C)C(=O)Nc2c(Cl)cccc21.
What is the InChIKey of 6-chloro-1-ethyl-3-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one?
The InChIKey is PTVYRVALOOBYNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClN2O/c1-3-15-7-8(2)12(16)14-11-9(13)5-4-6-10(11)15/h4-6,8H,3,7H2,1-2H3,(H,14,16).
What are the key properties of 6-chloro-1-ethyl-3-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one?
6-chloro-1-ethyl-3-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one has a molecular weight of 238.72 g/mol, XLogP of 2.75, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1-ethyl-3-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one is sourced from PubChem (CID 104839614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).