C13H15ClN2O — CID 114426902
4-chloro-8-methyl-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxalin-6-one (PubChem CID 114426902) has the molecular formula C13H15ClN2O and a molecular weight of 250.73 g/mol. Its IUPAC name is 4-chloro-8-methyl-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxalin-6-one.
| Compound Name | 4-chloro-8-methyl-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxalin-6-one |
|---|---|
| PubChem CID | 114426902 |
| Molecular Formula | C13H15ClN2O |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 4-chloro-8-methyl-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxalin-6-one |
| SMILES | CC1CCN2c3cccc(Cl)c3NC(=O)C2C1 |
| InChI | InChI=1S/C13H15ClN2O/c1-8-5-6-16-10-4-2-3-9(14)12(10)15-13(17)11(16)7-8/h2-4,8,11H,5-7H2,1H3,(H,15,17) |
| InChIKey | JCVKMDAKVXQCER-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |