C12H15ClN2O — CID 104839673
6-chloro-2-propyl-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one (PubChem CID 104839673) has the molecular formula C12H15ClN2O and a molecular weight of 238.72 g/mol. Its IUPAC name is 6-chloro-2-propyl-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one.
| Compound Name | 6-chloro-2-propyl-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one |
|---|---|
| PubChem CID | 104839673 |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 6-chloro-2-propyl-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one |
| SMILES | CCCC1CC(=O)Nc2c(Cl)cccc2N1 |
| InChI | InChI=1S/C12H15ClN2O/c1-2-4-8-7-11(16)15-12-9(13)5-3-6-10(12)14-8/h3,5-6,8,14H,2,4,7H2,1H3,(H,15,16) |
| InChIKey | HHDJPLMUBLVUPN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |